| Name |
5-[3-(2-tert-butyl-1H-1,3-benzodiazol-1-yl)azetidine-1-carbonyl]-4-methoxy-1-methyl-1,2-dihydropyridin-2-one
|
| Molecular Formula |
C22H26N4O3
|
| Molecular Weight |
394.5
|
| Smiles |
COc1cc(=O)n(C)cc1C(=O)N1CC(n2c(C(C)(C)C)nc3ccccc32)C1
|
COc1cc(=O)n(C)cc1C(=O)N1CC(n2c(C(C)(C)C)nc3ccccc32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.