| Name |
6-[2,2'-Dichloro-3'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,1'-biphenyl]-3-yl]-2-methoxy-3-pyridinecarboxaldehyde
|
| Molecular Formula |
C25H24BCl2NO4
|
| Molecular Weight |
484.2
|
| Smiles |
COc1nc(-c2cccc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3Cl)c2Cl)ccc1C=O
|
COc1nc(-c2cccc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3Cl)c2Cl)ccc1C=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.