| Name |
5-amino-1-phenyl-N-(1,3-thiazol-2-yl)-1H-1,2,3-triazole-4-carboxamide
|
| Molecular Formula |
C12H10N6OS
|
| Molecular Weight |
286.31
|
| Smiles |
Nc1c(C(=O)Nc2nccs2)nnn1-c1ccccc1
|
Nc1c(C(=O)Nc2nccs2)nnn1-c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.