| Name |
N-(2,6-Dichlorophenyl)-2,2,2-trifluoroacetimidoyl chloride
|
| Molecular Formula |
C8H3Cl3F3N
|
| Molecular Weight |
276.5
|
| Smiles |
FC(F)(F)C(Cl)=Nc1c(Cl)cccc1Cl
|
FC(F)(F)C(Cl)=Nc1c(Cl)cccc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.