| Name |
2-(1,3-Dioxoisoindolin-2-yl)-1,1,3,3-tetramethylisouronium hexafluorophosphate(V)
|
| Molecular Formula |
C13H16F6N3O3P
|
| Molecular Weight |
407.25
|
| Smiles |
CN(C)C(ON1C(=O)c2ccccc2C1=O)=[N+](C)C.F[P-](F)(F)(F)(F)F
|
CN(C)C(ON1C(=O)c2ccccc2C1=O)=[N+](C)C.F[P-](F)(F)(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.