| Name |
Brevetoxin B, 42-deoxo-41,43-dihydro-42-hydroxy-
|
| Molecular Formula |
C49H74O13
|
| Molecular Weight |
871.1
|
| Smiles |
CC1C=COC2CC3OC4CC(C)C5OC6CC7OC8(C)CC=CC9OC%10CC%11OC(C(C)CO)CC(O)C%11(C)OC%10CC9OC8CC7(C)OC6(C)CCC5OC4CC3(C)OC12
|
CC1C=COC2CC3OC4CC(C)C5OC6CC7OC8(C)CC=CC9OC%10CC%11OC(C(C)CO)CC(O)C%11(C)OC%10CC9OC8CC7(C)OC6(C)CCC5OC4CC3(C)OC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.