| Name |
N-Methyl-N-[(8-oxo-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methyl]sulfamoyl fluoride
|
| Molecular Formula |
C7H10FN5O3S
|
| Molecular Weight |
263.25
|
| Smiles |
CN(Cc1nnc2n1CCNC2=O)S(=O)(=O)F
|
CN(Cc1nnc2n1CCNC2=O)S(=O)(=O)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.