| Name |
(3As,6aS)-5,5-dioxo-1,2,3,3a,4,6-hexahydrothieno[3,4-b]pyrrole-6a-carboxylic acid;hydrochloride
|
| Molecular Formula |
C7H12ClNO4S
|
| Molecular Weight |
241.69
|
| Smiles |
Cl.O=C(O)C12CS(=O)(=O)CC1CCN2
|
Cl.O=C(O)C12CS(=O)(=O)CC1CCN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.