| Name |
5-(4-(Benzyloxy)-3,5-dibromophenyl)oxazole
|
| Molecular Formula |
C16H11Br2NO2
|
| Molecular Weight |
409.07
|
| Smiles |
Brc1cc(-c2cnco2)cc(Br)c1OCc1ccccc1
|
Brc1cc(-c2cnco2)cc(Br)c1OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.