| Name |
4-[(R)-[(1S,2S,4S,5R)-5-ethenyl-1-[[4-[4-[[(1S,2S,4S,5R)-5-ethenyl-2-[(R)-prop-2-enoxy(quinolin-4-yl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]phenyl]sulfonylphenyl]methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline
|
| Molecular Formula |
C58H64N4O4S+2
|
| Molecular Weight |
913.2
|
| Smiles |
C=CCOC(c1ccnc2ccccc12)C1CC2CC[N+]1(Cc1ccc(S(=O)(=O)c3ccc(C[N+]45CCC(CC4C(OCC=C)c4ccnc6ccccc46)C(C=C)C5)cc3)cc1)CC2C=C
|
C=CCOC(c1ccnc2ccccc12)C1CC2CC[N+]1(Cc1ccc(S(=O)(=O)c3ccc(C[N+]45CCC(CC4C(OCC=C)c4ccnc6ccccc46)C(C=C)C5)cc3)cc1)CC2C=C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.