| Name |
1-Naphthalenesulfonic acid, 4-hydroxy-3-[2-[4'-[2-(1-hydroxy-5-sulfo-2-naphthalenyl)diazenyl]-3,3'-dimethyl[1,1'-biphenyl]-4-yl]diazenyl]-
|
| Molecular Formula |
C34H26N4O8S2
|
| Molecular Weight |
682.7
|
| Smiles |
Cc1cc(-c2ccc(N=Nc3cc(S(=O)(=O)O)c4ccccc4c3O)c(C)c2)ccc1N=Nc1ccc2c(S(=O)(=O)O)cccc2c1O
|
Cc1cc(-c2ccc(N=Nc3cc(S(=O)(=O)O)c4ccccc4c3O)c(C)c2)ccc1N=Nc1ccc2c(S(=O)(=O)O)cccc2c1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.