| Name |
5-Acetoxy-2,4,6-triiodo-isophthalic acid bis-(2,3-dihydroxy-propyl) ester
|
| Molecular Formula |
C16H17I3O10
|
| Molecular Weight |
750.01
|
| Smiles |
CC(=O)Oc1c(I)c(C(=O)OCC(O)CO)c(I)c(C(=O)OCC(O)CO)c1I
|
CC(=O)Oc1c(I)c(C(=O)OCC(O)CO)c(I)c(C(=O)OCC(O)CO)c1I
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.