| Name |
2-{[1-({5H,6H,7H-pyrrolo[2,1-c][1,2,4]triazol-3-yl}methyl)piperidin-4-yl]methoxy}pyrimidine
|
| Molecular Formula |
C16H22N6O
|
| Molecular Weight |
314.39
|
| Smiles |
c1cnc(OCC2CCN(Cc3nnc4n3CCC4)CC2)nc1
|
c1cnc(OCC2CCN(Cc3nnc4n3CCC4)CC2)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.