| Name |
1-(3,3-diphenylpropyl)-5-imino-4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-2,5-dihydro-1H-pyrrol-3-ol
|
| Molecular Formula |
C29H27N3O2S
|
| Molecular Weight |
481.6
|
| Smiles |
COc1ccc(-c2csc(C3=C(O)CN(CCC(c4ccccc4)c4ccccc4)C3=N)n2)cc1
|
COc1ccc(-c2csc(C3=C(O)CN(CCC(c4ccccc4)c4ccccc4)C3=N)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.