| Name |
2,3,4-Trichlorobiphenyl-2',3',4',5',6'-d5
|
| Molecular Formula |
C12H7Cl3
|
| Molecular Weight |
262.6
|
| Smiles |
Clc1ccc(-c2ccccc2)c(Cl)c1Cl
|
Clc1ccc(-c2ccccc2)c(Cl)c1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.