| Name |
1-O-Tert-butyl 2-O-methyl (2R)-5-formyl-3,4-dihydro-2H-pyridine-1,2-dicarboxylate
|
| Molecular Formula |
C13H19NO5
|
| Molecular Weight |
269.29
|
| Smiles |
COC(=O)C1CCC(C=O)=CN1C(=O)OC(C)(C)C
|
COC(=O)C1CCC(C=O)=CN1C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.