| Name |
4-{4H,5H,6H,7H-thieno[3,2-c]pyridin-5-yl}-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine
|
| Molecular Formula |
C18H19F3N6S
|
| Molecular Weight |
408.4
|
| Smiles |
FC(F)(F)c1nnc2ccc(N3CCC(N4CCc5sccc5C4)CC3)nn12
|
FC(F)(F)c1nnc2ccc(N3CCC(N4CCc5sccc5C4)CC3)nn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.