| Name |
4-Chloro-5-(3,5-dichloro-4-methoxy-2,6-dimethylphenyl)-6-iodothieno[2,3-d]pyrimidine
|
| Molecular Formula |
C15H10Cl3IN2OS
|
| Molecular Weight |
499.6
|
| Smiles |
COc1c(Cl)c(C)c(-c2c(I)sc3ncnc(Cl)c23)c(C)c1Cl
|
COc1c(Cl)c(C)c(-c2c(I)sc3ncnc(Cl)c23)c(C)c1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.