| Name |
6-(Perfluoroethyl)pyrrolo[2,1-f][1,2,4]triazin-4-ol
|
| Molecular Formula |
C8H4F5N3O
|
| Molecular Weight |
253.13
|
| Smiles |
O=c1[nH]cnn2cc(C(F)(F)C(F)(F)F)cc12
|
O=c1[nH]cnn2cc(C(F)(F)C(F)(F)F)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.