| Name |
1-(3,4-Dichlorophenyl)-5-oxo-N-phenyl-2,5-dihydro-1H-1,2,4-triazole-3-carboxamide
|
| Molecular Formula |
C15H10Cl2N4O2
|
| Molecular Weight |
349.2
|
| Smiles |
O=C(Nc1ccccc1)c1nn(-c2ccc(Cl)c(Cl)c2)c(=O)[nH]1
|
O=C(Nc1ccccc1)c1nn(-c2ccc(Cl)c(Cl)c2)c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.