| Name |
1-(Biphenyl-4-yl)-2,5-dihydro-5-oxo-1H-1,2,4-triazole-3-carboxylic acid phenylamide
|
| Molecular Formula |
C21H16N4O2
|
| Molecular Weight |
356.4
|
| Smiles |
O=C(Nc1ccccc1)c1nn(-c2ccc(-c3ccccc3)cc2)c(=O)[nH]1
|
O=C(Nc1ccccc1)c1nn(-c2ccc(-c3ccccc3)cc2)c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.