| Name |
2-[[3-Carboxy-5-[[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl]amino]-2,4,6-triiodobenzoyl]amino]ethyl 1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetate
|
| Molecular Formula |
C30H19I3N4O10
|
| Molecular Weight |
976.2
|
| Smiles |
O=C(CN1C(=O)c2ccccc2C1=O)Nc1c(I)c(C(=O)O)c(I)c(C(=O)NCCOC(=O)CN2C(=O)c3ccccc3C2=O)c1I
|
O=C(CN1C(=O)c2ccccc2C1=O)Nc1c(I)c(C(=O)O)c(I)c(C(=O)NCCOC(=O)CN2C(=O)c3ccccc3C2=O)c1I
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.