| Name |
2-(4-Bromo-2,6-dichlorophenoxy)-N,N-dimethylacetamide
|
| Molecular Formula |
C10H10BrCl2NO2
|
| Molecular Weight |
327.00
|
| Smiles |
CN(C)C(=O)COc1c(Cl)cc(Br)cc1Cl
|
CN(C)C(=O)COc1c(Cl)cc(Br)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.