| Name |
2-({[3-(2,3-Dimethoxyphenyl)-1,2,4-oxadiazol-5-YL]methyl}sulfanyl)-6-phenylpyrimidin-4-OL
|
| Molecular Formula |
C21H18N4O4S
|
| Molecular Weight |
422.5
|
| Smiles |
COc1cccc(-c2noc(CSc3nc(-c4ccccc4)cc(=O)[nH]3)n2)c1OC
|
COc1cccc(-c2noc(CSc3nc(-c4ccccc4)cc(=O)[nH]3)n2)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.