| Name |
4-[(2-Amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol;1,1-dioxo-1,2-benzothiazol-3-one
|
| Molecular Formula |
C20H23Br2N3O4S
|
| Molecular Weight |
561.3
|
| Smiles |
Nc1c(Br)cc(Br)cc1CNC1CCC(O)CC1.O=C1NS(=O)(=O)c2ccccc21
|
Nc1c(Br)cc(Br)cc1CNC1CCC(O)CC1.O=C1NS(=O)(=O)c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.