| Name |
8,8'-(Cyclohexane-1,1-diylbis(benzene-4,1-diyl-(E)-diazene-2,1-diyl))bis(7-hydroxynaphthalene-1,3-disulfonic acid)
|
| Molecular Formula |
C38H32N4O14S4
|
| Molecular Weight |
896.9
|
| Smiles |
O=S(=O)(O)c1cc(S(=O)(=O)O)c2c(N=Nc3ccc(C4(c5ccc(N=Nc6c(O)ccc7cc(S(=O)(=O)O)cc(S(=O)(=O)O)c67)cc5)CCCCC4)cc3)c(O)ccc2c1
|
O=S(=O)(O)c1cc(S(=O)(=O)O)c2c(N=Nc3ccc(C4(c5ccc(N=Nc6c(O)ccc7cc(S(=O)(=O)O)cc(S(=O)(=O)O)c67)cc5)CCCCC4)cc3)c(O)ccc2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.