| Name |
(7E)-7-[(3,4-dihydroxyphenyl)methylidene]-12H-isoquinolino[2,3-a]quinazolin-5-one
|
| Molecular Formula |
C23H16N2O3
|
| Molecular Weight |
368.4
|
| Smiles |
O=c1nc2n(c3ccccc13)Cc1ccccc1C2=Cc1ccc(O)c(O)c1
|
O=c1nc2n(c3ccccc13)Cc1ccccc1C2=Cc1ccc(O)c(O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.