| Name |
2-(butylsulfanyl)-8,8-dimethyl-5-(5-methylthiophen-2-yl)-5,8,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6(3H,7H)-dione
|
| Molecular Formula |
C22H27N3O2S2
|
| Molecular Weight |
429.6
|
| Smiles |
CCCCSc1nc2c(c(=O)[nH]1)C(c1ccc(C)s1)C1=C(CC(C)(C)CC1=O)N2
|
CCCCSc1nc2c(c(=O)[nH]1)C(c1ccc(C)s1)C1=C(CC(C)(C)CC1=O)N2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.