| Name |
5-(2-(7-(3-(allyloxy)-2-hydroxypropyl)-1,3-dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)hydrazono)-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione
|
| Molecular Formula |
C19H24N8O7
|
| Molecular Weight |
476.4
|
| Smiles |
C=CCOCC(O)Cn1c(N=Nc2c(O)n(C)c(=O)n(C)c2=O)nc2c1c(=O)n(C)c(=O)n2C
|
C=CCOCC(O)Cn1c(N=Nc2c(O)n(C)c(=O)n(C)c2=O)nc2c1c(=O)n(C)c(=O)n2C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.