| Name |
1-[(1-benzyl-1H-1,2,3,4-tetrazol-5-yl)methyl]-1H-pyrazol-4-amine hydrochloride
|
| Molecular Formula |
C12H14ClN7
|
| Molecular Weight |
291.74
|
| Smiles |
Cl.Nc1cnn(Cc2nnnn2Cc2ccccc2)c1
|
Cl.Nc1cnn(Cc2nnnn2Cc2ccccc2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.