| Name |
2-(((4-oxo-3-phenyl-3,4-dihydroquinazolin-2-yl)thio)methyl)-3H-spiro[benzo[h]quinazoline-5,1'-cyclohexan]-4(6H)-one
|
| Molecular Formula |
C32H28N4O2S
|
| Molecular Weight |
532.7
|
| Smiles |
O=c1[nH]c(CSc2nc3ccccc3c(=O)n2-c2ccccc2)nc2c1C1(CCCCC1)Cc1ccccc1-2
|
O=c1[nH]c(CSc2nc3ccccc3c(=O)n2-c2ccccc2)nc2c1C1(CCCCC1)Cc1ccccc1-2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.