| Name |
3-(5-Amino-7-hydroxy-[1,2,3]triazolo[4,5-D]pyrimidin-2-YL)-benzoic acid
|
| Molecular Formula |
C11H8N6O3
|
| Molecular Weight |
272.22
|
| Smiles |
Nc1nc2nn(-c3cccc(C(=O)O)c3)nc2c(=O)[nH]1
|
Nc1nc2nn(-c3cccc(C(=O)O)c3)nc2c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.