| Name |
3-(4-Chlorophenyl)-4-imino-6-(4-methoxyphenyl)-1,3,7-trihydro-5,7-diazaquinazoline-2,8-dione
|
| Molecular Formula |
C19H14ClN5O3
|
| Molecular Weight |
395.8
|
| Smiles |
COc1ccc(-c2nc3c(N)n(-c4ccc(Cl)cc4)c(=O)nc3c(=O)[nH]2)cc1
|
COc1ccc(-c2nc3c(N)n(-c4ccc(Cl)cc4)c(=O)nc3c(=O)[nH]2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.