| Name |
2,2'-(((1,2-Diphenylethene-1,2-diyl)bis(4,1-phenylene))bis(oxy))bis(N,N,N-trimethylethanaminium)
|
| Molecular Formula |
C36H44N2O2+2
|
| Molecular Weight |
536.7
|
| Smiles |
C[N+](C)(C)CCOc1ccc(C(=C(c2ccccc2)c2ccc(OCC[N+](C)(C)C)cc2)c2ccccc2)cc1
|
C[N+](C)(C)CCOc1ccc(C(=C(c2ccccc2)c2ccc(OCC[N+](C)(C)C)cc2)c2ccccc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.