| Name |
5-Methyl-7-(pyridin-3-yl)-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide
|
| Molecular Formula |
C21H22N6O4
|
| Molecular Weight |
422.4
|
| Smiles |
COc1cc(-c2nc3n(n2)C(c2cccnc2)C(C(N)=O)=C(C)N3)cc(OC)c1OC
|
COc1cc(-c2nc3n(n2)C(c2cccnc2)C(C(N)=O)=C(C)N3)cc(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.