| Name |
Mercurate(2-a)a, [orthoborato(3-a)a-aI masculineO]aphenyl-
|
| Molecular Formula |
C6H5BHgO3-2
|
| Molecular Weight |
336.51
|
| Smiles |
[Hg+2].[O-]B([O-])[O-].[c-]1ccccc1
|
[Hg+2].[O-]B([O-])[O-].[c-]1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.