| Name |
4-({4-[6-(4-Fluorophenyl)pyridazin-3-yl]piperazin-1-yl}methyl)-1-methyl-1,2-dihydropyridin-2-one
|
| Molecular Formula |
C21H22FN5O
|
| Molecular Weight |
379.4
|
| Smiles |
Cn1ccc(CN2CCN(c3ccc(-c4ccc(F)cc4)nn3)CC2)cc1=O
|
Cn1ccc(CN2CCN(c3ccc(-c4ccc(F)cc4)nn3)CC2)cc1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.