| Name |
1,1,1,2,2,3,3,4,4-Nonafluoro-6-iodo-7,7-dimethyloctane
|
| Molecular Formula |
C10H12F9I
|
| Molecular Weight |
430.09
|
| Smiles |
CC(C)(C)C(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F
|
CC(C)(C)C(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.