| Name |
6-[[2-(1,3,3a,4,7,7a-Hexahydro-5-methyl-1,3-dioxo-2H-isoindol-2-yl)benzoyl]amino]hexanoic acid
|
| Molecular Formula |
C22H26N2O5
|
| Molecular Weight |
398.5
|
| Smiles |
CC1=CCC2C(=O)N(c3ccccc3C(=O)NCCCCCC(=O)O)C(=O)C2C1
|
CC1=CCC2C(=O)N(c3ccccc3C(=O)NCCCCCC(=O)O)C(=O)C2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.