| Name |
3,3'-((oxybis(4,1-phenylene))bis(azanediyl))bis(6-(tert-butyl)-1,2,4-triazin-5(4H)-one)
|
| Molecular Formula |
C26H30N8O3
|
| Molecular Weight |
502.6
|
| Smiles |
CC(C)(C)c1nnc(Nc2ccc(Oc3ccc(Nc4nnc(C(C)(C)C)c(=O)[nH]4)cc3)cc2)[nH]c1=O
|
CC(C)(C)c1nnc(Nc2ccc(Oc3ccc(Nc4nnc(C(C)(C)C)c(=O)[nH]4)cc3)cc2)[nH]c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.