| Name |
Tert-butyl 4-(4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazol-2-yl)piperidine-1-carboxylate
|
| Molecular Formula |
C20H33BN2O4S
|
| Molecular Weight |
408.4
|
| Smiles |
Cc1nc(C2CCN(C(=O)OC(C)(C)C)CC2)sc1B1OC(C)(C)C(C)(C)O1
|
Cc1nc(C2CCN(C(=O)OC(C)(C)C)CC2)sc1B1OC(C)(C)C(C)(C)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.