| Name |
(S)-2-{5-[Methyl-(3-methyl-1-oxo-1,2-dihydro-benzo[f]quinazolin-9-ylmethyl)-amino]-1-oxo-1,3-dihydro-isoindol-2-yl}-pentanedioic acid
|
| Molecular Formula |
C28H26N4O6
|
| Molecular Weight |
514.5
|
| Smiles |
Cc1nc2ccc3ccc(CN(C)c4ccc5c(c4)CN(C(CCC(=O)O)C(=O)O)C5=O)cc3c2c(=O)[nH]1
|
Cc1nc2ccc3ccc(CN(C)c4ccc5c(c4)CN(C(CCC(=O)O)C(=O)O)C5=O)cc3c2c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.