| Name |
3-Amino-4-(2-methoxyethyl)-4,9,16-triazatetracyclo[7.7.0.0^{2,6}.0^{10,15}]hexadeca-1(16),2,6,10(15),11,13-hexaen-8-one
|
| Molecular Formula |
C16H16N4O2
|
| Molecular Weight |
296.32
|
| Smiles |
COCCN1Cc2cc(=O)n3c([nH]c4ccccc43)c2C1=N
|
COCCN1Cc2cc(=O)n3c([nH]c4ccccc43)c2C1=N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.