| Name |
1-(4-((6-Amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9(8H)-yl)methyl)phenyl)-3,6-dioxo-10,13,16-trioxa-2,7-diazanonadecan-19-oic acid
|
| Molecular Formula |
C29H41N7O10
|
| Molecular Weight |
647.7
|
| Smiles |
COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNC(=O)CCC(=O)NCCOCCOCCOCCC(=O)O)cc3)c2n1
|
COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNC(=O)CCC(=O)NCCOCCOCCOCCC(=O)O)cc3)c2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.