| Name |
2-{[4-(3,4-Dihydroxyphenyl)-1,3-thiazol-2-yl]sulfanyl}acetic acid
|
| Molecular Formula |
C11H9NO4S2
|
| Molecular Weight |
283.3
|
| Smiles |
O=C(O)CSc1nc(-c2ccc(O)c(O)c2)cs1
|
O=C(O)CSc1nc(-c2ccc(O)c(O)c2)cs1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.