| Name |
2-{4-[(3Z)-1-methyl-2-oxo-2,3-dihydro-1H-indol-3-ylidene]-5-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl}acetic acid
|
| Molecular Formula |
C14H10N2O4S2
|
| Molecular Weight |
334.4
|
| Smiles |
CN1C(=O)C(=C2C(=O)SC(=S)N2CC(=O)O)c2ccccc21
|
CN1C(=O)C(=C2C(=O)SC(=S)N2CC(=O)O)c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.