| Name |
Tert-butyl (1-(4-(1,5-dimethyl-6-oxo-1,6-dihydropyridin-3-yl)-2,6-dimethoxybenzyl)azetidin-3-yl)carbamate
|
| Molecular Formula |
C24H33N3O5
|
| Molecular Weight |
443.5
|
| Smiles |
COc1cc(-c2cc(C)c(=O)n(C)c2)cc(OC)c1CN1CC(NC(=O)OC(C)(C)C)C1
|
COc1cc(-c2cc(C)c(=O)n(C)c2)cc(OC)c1CN1CC(NC(=O)OC(C)(C)C)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.