| Name |
6-Bromo-2-phenylthieno[3,2-d]pyrimidin-4(3h)-one
|
| Molecular Formula |
C12H7BrN2OS
|
| Molecular Weight |
307.17
|
| Smiles |
O=c1[nH]c(-c2ccccc2)nc2cc(Br)sc12
|
O=c1[nH]c(-c2ccccc2)nc2cc(Br)sc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.