| Name |
Tert-butyl 6'-hydroxy-2',3'-dihydro-1'h-spiro[cyclopropane-1,4'-isoquinoline]-2'-carboxylate
|
| Molecular Formula |
C16H21NO3
|
| Molecular Weight |
275.34
|
| Smiles |
CC(C)(C)OC(=O)N1Cc2ccc(O)cc2C2(CC2)C1
|
CC(C)(C)OC(=O)N1Cc2ccc(O)cc2C2(CC2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.