| Name |
4-({3-[(1H-1,2,4-triazol-1-yl)methyl]azetidin-1-yl}sulfonyl)-2,1,3-benzothiadiazole
|
| Molecular Formula |
C12H12N6O2S2
|
| Molecular Weight |
336.4
|
| Smiles |
O=S(=O)(c1cccc2nsnc12)N1CC(Cn2cncn2)C1
|
O=S(=O)(c1cccc2nsnc12)N1CC(Cn2cncn2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.